C17H26FNO — CID 115997052
3-[cyclohexyl(methyl)amino]-1-(2-fluorophenyl)-2-methylpropan-1-ol (PubChem CID 115997052) has the molecular formula C17H26FNO and a molecular weight of 279.40 g/mol. Its IUPAC name is 3-[cyclohexyl(methyl)amino]-1-(2-fluorophenyl)-2-methylpropan-1-ol.
| Compound Name | 3-[cyclohexyl(methyl)amino]-1-(2-fluorophenyl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 115997052 |
| Molecular Formula | C17H26FNO |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 3-[cyclohexyl(methyl)amino]-1-(2-fluorophenyl)-2-methylpropan-1-ol |
| SMILES | CC(CN(C)C1CCCCC1)C(O)c1ccccc1F |
| InChI | InChI=1S/C17H26FNO/c1-13(12-19(2)14-8-4-3-5-9-14)17(20)15-10-6-7-11-16(15)18/h6-7,10-11,13-14,17,20H,3-5,8-9,12H2,1-2H3 |
| InChIKey | SYPONROOLDKZRX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |