C19H26N2 — CID 62619815
N'-(4-ethylphenyl)-N',2-dimethyl-1-phenylpropane-1,3-diamine (PubChem CID 62619815) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N'-(4-ethylphenyl)-N',2-dimethyl-1-phenylpropane-1,3-diamine.
| Compound Name | N'-(4-ethylphenyl)-N',2-dimethyl-1-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62619815 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N'-(4-ethylphenyl)-N',2-dimethyl-1-phenylpropane-1,3-diamine |
| SMILES | CCc1ccc(N(C)CC(C)C(N)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H26N2/c1-4-16-10-12-18(13-11-16)21(3)14-15(2)19(20)17-8-6-5-7-9-17/h5-13,15,19H,4,14,20H2,1-3H3 |
| InChIKey | UUAHTHYHGABUJK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|