C12H21N3 — CID 115119487
3-N-(4-ethylphenyl)-3-N-methylpropane-1,2,3-triamine (PubChem CID 115119487) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-N-(4-ethylphenyl)-3-N-methylpropane-1,2,3-triamine.
| Compound Name | 3-N-(4-ethylphenyl)-3-N-methylpropane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119487 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 3-N-(4-ethylphenyl)-3-N-methylpropane-1,2,3-triamine |
| SMILES | CCc1ccc(N(C)CC(N)CN)cc1 |
| InChI | InChI=1S/C12H21N3/c1-3-10-4-6-12(7-5-10)15(2)9-11(14)8-13/h4-7,11H,3,8-9,13-14H2,1-2H3 |
| InChIKey | KPKIUVFEHIYEFR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|