C15H26N2O — CID 63070653
2-ethoxy-N'-(4-ethylphenyl)-N'-methylbutane-1,4-diamine (PubChem CID 63070653) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-ethoxy-N'-(4-ethylphenyl)-N'-methylbutane-1,4-diamine.
| Compound Name | 2-ethoxy-N'-(4-ethylphenyl)-N'-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 63070653 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 2-ethoxy-N'-(4-ethylphenyl)-N'-methylbutane-1,4-diamine |
| SMILES | CCOC(CN)CCN(C)c1ccc(CC)cc1 |
| InChI | InChI=1S/C15H26N2O/c1-4-13-6-8-14(9-7-13)17(3)11-10-15(12-16)18-5-2/h6-9,15H,4-5,10-12,16H2,1-3H3 |
| InChIKey | HYFKMKCVFWQNIE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|