C8H20N2O — CID 95006031
(2R)-2-ethoxy-N',N'-dimethylbutane-1,4-diamine (PubChem CID 95006031) has the molecular formula C8H20N2O and a molecular weight of 160.26 g/mol. Its IUPAC name is (2R)-2-ethoxy-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | (2R)-2-ethoxy-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 95006031 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | (2R)-2-ethoxy-N',N'-dimethylbutane-1,4-diamine |
| SMILES | CCO[C@@H](CN)CCN(C)C |
| InChI | InChI=1S/C8H20N2O/c1-4-11-8(7-9)5-6-10(2)3/h8H,4-7,9H2,1-3H3/t8-/m1/s1 |
| InChIKey | UDYGMTDODPECSM-MRVPVSSYSA-N |
| XLogP | 0.30 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |