C9H21N3O2 — CID 63070450
2-[(4-amino-3-ethoxybutyl)-methylamino]acetamide (PubChem CID 63070450) has the molecular formula C9H21N3O2 and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-[(4-amino-3-ethoxybutyl)-methylamino]acetamide.
| Compound Name | 2-[(4-amino-3-ethoxybutyl)-methylamino]acetamide |
|---|---|
| PubChem CID | 63070450 |
| Molecular Formula | C9H21N3O2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.16 |
| IUPAC Name | 2-[(4-amino-3-ethoxybutyl)-methylamino]acetamide |
| SMILES | CCOC(CN)CCN(C)CC(N)=O |
| InChI | InChI=1S/C9H21N3O2/c1-3-14-8(6-10)4-5-12(2)7-9(11)13/h8H,3-7,10H2,1-2H3,(H2,11,13) |
| InChIKey | RMLWOLCDJXKEQW-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |