C7H18N2O — CID 83826305
2-methoxy-N',N'-dimethylbutane-1,4-diamine (PubChem CID 83826305) has the molecular formula C7H18N2O and a molecular weight of 146.23 g/mol. Its IUPAC name is 2-methoxy-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | 2-methoxy-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 83826305 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | 2-methoxy-N',N'-dimethylbutane-1,4-diamine |
| SMILES | COC(CN)CCN(C)C |
| InChI | InChI=1S/C7H18N2O/c1-9(2)5-4-7(6-8)10-3/h7H,4-6,8H2,1-3H3 |
| InChIKey | HTDINZOBXRROQU-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |