About 2-methoxy-N',N'-dimethylbutane-1,4-diamine
2-methoxy-N',N'-dimethylbutane-1,4-diamine (PubChem CID 83826305) has the molecular formula C7H18N2O
and a molecular weight of 146.23 g/mol. Its IUPAC name is 2-methoxy-N',N'-dimethylbutane-1,4-diamine.
Molecular Properties
| Compound Name | 2-methoxy-N',N'-dimethylbutane-1,4-diamine |
| PubChem CID | 83826305 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | 2-methoxy-N',N'-dimethylbutane-1,4-diamine |
| SMILES | COC(CN)CCN(C)C |
| InChI | InChI=1S/C7H18N2O/c1-9(2)5-4-7(6-8)10-3/h7H,4-6,8H2,1-3H3 |
| InChIKey | HTDINZOBXRROQU-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-N',N'-dimethylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N',N'-dimethylbutane-1,4-diamine?
The IUPAC name of 2-methoxy-N',N'-dimethylbutane-1,4-diamine (CID 83826305) is 2-methoxy-N',N'-dimethylbutane-1,4-diamine.
What is the SMILES notation for 2-methoxy-N',N'-dimethylbutane-1,4-diamine?
The canonical SMILES for 2-methoxy-N',N'-dimethylbutane-1,4-diamine is COC(CN)CCN(C)C.
What is the InChIKey of 2-methoxy-N',N'-dimethylbutane-1,4-diamine?
The InChIKey is HTDINZOBXRROQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2O/c1-9(2)5-4-7(6-8)10-3/h7H,4-6,8H2,1-3H3.
What are the key properties of 2-methoxy-N',N'-dimethylbutane-1,4-diamine?
2-methoxy-N',N'-dimethylbutane-1,4-diamine has a molecular weight of 146.23 g/mol, XLogP of -0.09, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N',N'-dimethylbutane-1,4-diamine is sourced from PubChem (CID 83826305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).