C8H20N2O2 — CID 141495487
2,5-dimethoxyhexane-1,6-diamine (PubChem CID 141495487) has the molecular formula C8H20N2O2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,5-dimethoxyhexane-1,6-diamine.
| Compound Name | 2,5-dimethoxyhexane-1,6-diamine |
|---|---|
| PubChem CID | 141495487 |
| Molecular Formula | C8H20N2O2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | 2,5-dimethoxyhexane-1,6-diamine |
| SMILES | COC(CN)CCC(CN)OC |
| InChI | InChI=1S/C8H20N2O2/c1-11-7(5-9)3-4-8(6-10)12-2/h7-8H,3-6,9-10H2,1-2H3 |
| InChIKey | PBYGDGUPLMTCPW-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |