C11H24N2O3 — CID 103534891
4-(3,4-dimethoxypyrrolidin-1-yl)-2-methoxybutan-1-amine (PubChem CID 103534891) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is 4-(3,4-dimethoxypyrrolidin-1-yl)-2-methoxybutan-1-amine.
| Compound Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-2-methoxybutan-1-amine |
|---|---|
| PubChem CID | 103534891 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-2-methoxybutan-1-amine |
| SMILES | COC(CN)CCN1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C11H24N2O3/c1-14-9(6-12)4-5-13-7-10(15-2)11(8-13)16-3/h9-11H,4-8,12H2,1-3H3 |
| InChIKey | XAMFIKRNYAWHDA-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |