C9H20N2O2 — CID 129498587
2-[(3R,4R)-3-ethoxy-4-methoxypyrrolidin-1-yl]ethanamine (PubChem CID 129498587) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-[(3R,4R)-3-ethoxy-4-methoxypyrrolidin-1-yl]ethanamine.
| Compound Name | 2-[(3R,4R)-3-ethoxy-4-methoxypyrrolidin-1-yl]ethanamine |
|---|---|
| PubChem CID | 129498587 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 2-[(3R,4R)-3-ethoxy-4-methoxypyrrolidin-1-yl]ethanamine |
| SMILES | CCO[C@@H]1CN(CCN)C[C@H]1OC |
| InChI | InChI=1S/C9H20N2O2/c1-3-13-9-7-11(5-4-10)6-8(9)12-2/h8-9H,3-7,10H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | IGEAOKITHAWZRW-RKDXNWHRSA-N |
| XLogP | -0.32 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |