About 3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one
3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one (PubChem CID 129496844) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one |
| PubChem CID | 129496844 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one |
| SMILES | CCO[C@H]1CN(C(=O)CCN)C[C@H]1OCC |
| InChI | InChI=1S/C11H22N2O3/c1-3-15-9-7-13(11(14)5-6-12)8-10(9)16-4-2/h9-10H,3-8,12H2,1-2H3/t9-,10+ |
| InChIKey | FKEPICUEQVYWDO-AOOOYVTPSA-N |
| XLogP | -0.01 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one?
The IUPAC name of 3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one (CID 129496844) is 3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one.
What is the SMILES notation for 3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one?
The canonical SMILES for 3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one is CCO[C@H]1CN(C(=O)CCN)C[C@H]1OCC.
What is the InChIKey of 3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one?
The InChIKey is FKEPICUEQVYWDO-AOOOYVTPSA-N. The full InChI is InChI=1S/C11H22N2O3/c1-3-15-9-7-13(11(14)5-6-12)8-10(9)16-4-2/h9-10H,3-8,12H2,1-2H3/t9-,10+.
What are the key properties of 3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one?
3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one has a molecular weight of 230.31 g/mol, XLogP of -0.01, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-[(3R,4S)-3,4-diethoxypyrrolidin-1-yl]propan-1-one is sourced from PubChem (CID 129496844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).