C43H78N2O3 — CID 123578353
3-amino-1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]propan-1-one (PubChem CID 123578353) has the molecular formula C43H78N2O3 and a molecular weight of 671.11 g/mol. Its IUPAC name is 3-amino-1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-amino-1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 123578353 |
| Molecular Formula | C43H78N2O3 |
| Molecular Weight | 671.11 g/mol |
| Exact Mass | 670.60 |
| IUPAC Name | 3-amino-1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]propan-1-one |
| SMILES | CCCCCC=CCC=CCCCCCCCCOC1CN(C(=O)CCN)C[C@H]1OCCCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C43H78N2O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-47-41-39-45(43(46)35-36-44)40-42(41)48-38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,41-42H,3-10,15-16,21-40,44H2,1-2H3/t41-,42?/m1/s1 |
| InChIKey | YSGHGHNPQLMZLB-HRCVVWNVSA-N |
| XLogP | 11.57 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.11 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|