C44H80N2O3 — CID 123672432
1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]-2-(dimethylamino)ethanone (PubChem CID 123672432) has the molecular formula C44H80N2O3 and a molecular weight of 685.13 g/mol. Its IUPAC name is 1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]-2-(dimethylamino)ethanone.
| Compound Name | 1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]-2-(dimethylamino)ethanone |
|---|---|
| PubChem CID | 123672432 |
| Molecular Formula | C44H80N2O3 |
| Molecular Weight | 685.13 g/mol |
| Exact Mass | 684.62 |
| IUPAC Name | 1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]-2-(dimethylamino)ethanone |
| SMILES | CCCCCC=CCC=CCCCCCCCCOC1CN(C(=O)CN(C)C)C[C@H]1OCCCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C44H80N2O3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-48-42-39-46(44(47)41-45(3)4)40-43(42)49-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,42-43H,5-12,17-18,23-41H2,1-4H3/t42-,43?/m1/s1 |
| InChIKey | FPGPFSINKCUBSO-YXOISFJGSA-N |
| XLogP | 11.79 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.13 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|