C31H59NO4S — CID 67517949
1-methylsulfonyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-octoxypyrrolidine (PubChem CID 67517949) has the molecular formula C31H59NO4S and a molecular weight of 541.88 g/mol. Its IUPAC name is 1-methylsulfonyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-octoxypyrrolidine.
| Compound Name | 1-methylsulfonyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-octoxypyrrolidine |
|---|---|
| PubChem CID | 67517949 |
| Molecular Formula | C31H59NO4S |
| Molecular Weight | 541.88 g/mol |
| Exact Mass | 541.42 |
| IUPAC Name | 1-methylsulfonyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-octoxypyrrolidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC1CN(S(C)(=O)=O)CC1OCCCCCCCC |
| InChI | InChI=1S/C31H59NO4S/c1-4-6-8-10-12-13-14-15-16-17-18-19-20-21-23-25-27-36-31-29-32(37(3,33)34)28-30(31)35-26-24-22-11-9-7-5-2/h12-13,15-16,30-31H,4-11,14,17-29H2,1-3H3/b13-12-,16-15- |
| InChIKey | FIVPJUVEXGLMRS-QGLGPCELSA-N |
| XLogP | 8.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.88 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|