C44H81NO3 — CID 134227574
(3R,4R)-1-(3-methoxypropyl)-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine (PubChem CID 134227574) has the molecular formula C44H81NO3 and a molecular weight of 672.14 g/mol. Its IUPAC name is (3R,4R)-1-(3-methoxypropyl)-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine.
| Compound Name | (3R,4R)-1-(3-methoxypropyl)-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine |
|---|---|
| PubChem CID | 134227574 |
| Molecular Formula | C44H81NO3 |
| Molecular Weight | 672.14 g/mol |
| Exact Mass | 671.62 |
| IUPAC Name | (3R,4R)-1-(3-methoxypropyl)-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCO[C@@H]1CN(CCCOC)C[C@H]1OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C44H81NO3/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-39-47-43-41-45(37-36-38-46-3)42-44(43)48-40-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,43-44H,4-11,16-17,22-42H2,1-3H3/b14-12-,15-13-,20-18-,21-19-/t43-,44-/m1/s1 |
| InChIKey | IAVTYBNTTPLBDO-PMJOZSTPSA-N |
| XLogP | 12.74 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.14 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|