C42H77NO2 — CID 46220312
(3S,4R)-1-methyl-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]piperidine (PubChem CID 46220312) has the molecular formula C42H77NO2 and a molecular weight of 628.08 g/mol. Its IUPAC name is (3S,4R)-1-methyl-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]piperidine.
| Compound Name | (3S,4R)-1-methyl-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]piperidine |
|---|---|
| PubChem CID | 46220312 |
| Molecular Formula | C42H77NO2 |
| Molecular Weight | 628.08 g/mol |
| Exact Mass | 627.60 |
| IUPAC Name | (3S,4R)-1-methyl-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]piperidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCO[C@H]1CN(C)CC[C@H]1OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C42H77NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38-44-41-36-37-43(3)40-42(41)45-39-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,41-42H,4-11,16-17,22-40H2,1-3H3/b14-12-,15-13-,20-18-,21-19-/t41-,42+/m1/s1 |
| InChIKey | DFWNBIXIVOUJPO-HWNDXIDTSA-N |
| XLogP | 12.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.08 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|