C43H78O2 — CID 170018388
(1S,2R,4R)-4-methyl-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclohexane (PubChem CID 170018388) has the molecular formula C43H78O2 and a molecular weight of 627.09 g/mol. Its IUPAC name is (1S,2R,4R)-4-methyl-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclohexane.
| Compound Name | (1S,2R,4R)-4-methyl-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclohexane |
|---|---|
| PubChem CID | 170018388 |
| Molecular Formula | C43H78O2 |
| Molecular Weight | 627.09 g/mol |
| Exact Mass | 626.60 |
| IUPAC Name | (1S,2R,4R)-4-methyl-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclohexane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCO[C@H]1CC[C@@H](C)C[C@H]1OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C43H78O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38-44-42-37-36-41(3)40-43(42)45-39-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,41-43H,4-11,16-17,22-40H2,1-3H3/b14-12-,15-13-,20-18-,21-19-/t41-,42+,43-/m1/s1 |
| InChIKey | FLTDYLNVJRNQLK-VJFPZTERSA-N |
| XLogP | 14.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.09 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|