C40H73NO2 — CID 86699633
(3R,4R)-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine (PubChem CID 86699633) has the molecular formula C40H73NO2 and a molecular weight of 600.03 g/mol. Its IUPAC name is (3R,4R)-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine.
| Compound Name | (3R,4R)-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine |
|---|---|
| PubChem CID | 86699633 |
| Molecular Formula | C40H73NO2 |
| Molecular Weight | 600.03 g/mol |
| Exact Mass | 599.56 |
| IUPAC Name | (3R,4R)-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCO[C@@H]1CNC[C@H]1OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C40H73NO2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-42-39-37-41-38-40(39)43-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,39-41H,3-10,15-16,21-38H2,1-2H3/b13-11-,14-12-,19-17-,20-18-/t39-,40-/m1/s1 |
| InChIKey | YYFCEOUPFKULAN-QGQSHSPHSA-N |
| XLogP | 11.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.03 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|