C41H74O2 — CID 134314198
cis-(1S,2R)-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclopentane (PubChem CID 134314198) has the molecular formula C41H74O2 and a molecular weight of 599.04 g/mol. Its IUPAC name is cis-(1S,2R)-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclopentane.
| Compound Name | cis-(1S,2R)-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclopentane |
|---|---|
| PubChem CID | 134314198 |
| Molecular Formula | C41H74O2 |
| Molecular Weight | 599.04 g/mol |
| Exact Mass | 598.57 |
| IUPAC Name | cis-(1S,2R)-1,2-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclopentane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCO[C@H]1CCC[C@H]1OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C41H74O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38-42-40-36-35-37-41(40)43-39-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,40-41H,3-10,15-16,21-39H2,1-2H3/b13-11-,14-12-,19-17-,20-18-/t40-,41+ |
| InChIKey | GTQWHDVMNUXZLW-YYZPTHPSSA-N |
| XLogP | 13.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.04 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|