About (2-hexoxycyclopentyl) formate
(2-hexoxycyclopentyl) formate (PubChem CID 57110309) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is (2-hexoxycyclopentyl) formate.
Molecular Properties
| Compound Name | (2-hexoxycyclopentyl) formate |
| PubChem CID | 57110309 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (2-hexoxycyclopentyl) formate |
| SMILES | CCCCCCOC1CCCC1OC=O |
| InChI | InChI=1S/C12H22O3/c1-2-3-4-5-9-14-11-7-6-8-12(11)15-10-13/h10-12H,2-9H2,1H3 |
| InChIKey | QSBICXAQBYTJCD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-hexoxycyclopentyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hexoxycyclopentyl) formate?
The IUPAC name of (2-hexoxycyclopentyl) formate (CID 57110309) is (2-hexoxycyclopentyl) formate.
What is the SMILES notation for (2-hexoxycyclopentyl) formate?
The canonical SMILES for (2-hexoxycyclopentyl) formate is CCCCCCOC1CCCC1OC=O.
What is the InChIKey of (2-hexoxycyclopentyl) formate?
The InChIKey is QSBICXAQBYTJCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-2-3-4-5-9-14-11-7-6-8-12(11)15-10-13/h10-12H,2-9H2,1H3.
What are the key properties of (2-hexoxycyclopentyl) formate?
(2-hexoxycyclopentyl) formate has a molecular weight of 214.30 g/mol, XLogP of 2.68, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hexoxycyclopentyl) formate is sourced from PubChem (CID 57110309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).