C43H79NO2 — CID 90138260
(1R,3S,4R)-N-methyl-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclohexan-1-amine (PubChem CID 90138260) has the molecular formula C43H79NO2 and a molecular weight of 642.11 g/mol. Its IUPAC name is (1R,3S,4R)-N-methyl-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclohexan-1-amine.
| Compound Name | (1R,3S,4R)-N-methyl-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclohexan-1-amine |
|---|---|
| PubChem CID | 90138260 |
| Molecular Formula | C43H79NO2 |
| Molecular Weight | 642.11 g/mol |
| Exact Mass | 641.61 |
| IUPAC Name | (1R,3S,4R)-N-methyl-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclohexan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCO[C@H]1C[C@H](NC)CC[C@H]1OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C43H79NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38-45-42-37-36-41(44-3)40-43(42)46-39-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,41-44H,4-11,16-17,22-40H2,1-3H3/b14-12-,15-13-,20-18-,21-19-/t41-,42-,43+/m1/s1 |
| InChIKey | RFEDDTYGWAAZNO-VNRSREBTSA-N |
| XLogP | 13.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.11 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|