C43H76O4 — CID 89239634
[3,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclohexyl] formate (PubChem CID 89239634) has the molecular formula C43H76O4 and a molecular weight of 657.08 g/mol. Its IUPAC name is [3,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclohexyl] formate.
| Compound Name | [3,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclohexyl] formate |
|---|---|
| PubChem CID | 89239634 |
| Molecular Formula | C43H76O4 |
| Molecular Weight | 657.08 g/mol |
| Exact Mass | 656.57 |
| IUPAC Name | [3,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]cyclohexyl] formate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC1CC(OC=O)CC(OCCCCCCCC/C=C\C/C=C\CCCCC)C1 |
| InChI | InChI=1S/C43H76O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-45-41-37-42(39-43(38-41)47-40-44)46-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,40-43H,3-10,15-16,21-39H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | ZBYVGKRUUDZAGH-MAZCIEHSSA-N |
| XLogP | 13.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.08 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|