C43H79NO4 — CID 86699635
3-[(3R,4R)-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidin-1-yl]propane-1,2-diol (PubChem CID 86699635) has the molecular formula C43H79NO4 and a molecular weight of 674.11 g/mol. Its IUPAC name is 3-[(3R,4R)-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidin-1-yl]propane-1,2-diol.
| Compound Name | 3-[(3R,4R)-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidin-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 86699635 |
| Molecular Formula | C43H79NO4 |
| Molecular Weight | 674.11 g/mol |
| Exact Mass | 673.60 |
| IUPAC Name | 3-[(3R,4R)-3,4-bis[(9Z,12Z)-octadeca-9,12-dienoxy]pyrrolidin-1-yl]propane-1,2-diol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCO[C@@H]1CN(CC(O)CO)C[C@H]1OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C43H79NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-47-42-38-44(37-41(46)40-45)39-43(42)48-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,41-43,45-46H,3-10,15-16,21-40H2,1-2H3/b13-11-,14-12-,19-17-,20-18-/t41?,42-,43-/m1/s1 |
| InChIKey | DNPBLNKOGLNHOY-PZYNCWBWSA-N |
| XLogP | 11.05 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.11 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|