C43H79NO3 — CID 123212503
1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]propan-2-ol (PubChem CID 123212503) has the molecular formula C43H79NO3 and a molecular weight of 658.11 g/mol. Its IUPAC name is 1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]propan-2-ol.
| Compound Name | 1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 123212503 |
| Molecular Formula | C43H79NO3 |
| Molecular Weight | 658.11 g/mol |
| Exact Mass | 657.61 |
| IUPAC Name | 1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]propan-2-ol |
| SMILES | CCCCCC=CCC=CCCCCCCCCOC1CN(CC(C)O)C[C@H]1OCCCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C43H79NO3/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-46-42-39-44(38-41(3)45)40-43(42)47-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,41-43,45H,4-11,16-17,22-40H2,1-3H3/t41?,42-,43?/m1/s1 |
| InChIKey | PWVNFZDYTKZZTK-RKMLJCJOSA-N |
| XLogP | 12.08 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.11 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|