C42H76N2O3 — CID 123967808
2-amino-1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]ethanone (PubChem CID 123967808) has the molecular formula C42H76N2O3 and a molecular weight of 657.08 g/mol. Its IUPAC name is 2-amino-1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-amino-1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 123967808 |
| Molecular Formula | C42H76N2O3 |
| Molecular Weight | 657.08 g/mol |
| Exact Mass | 656.59 |
| IUPAC Name | 2-amino-1-[(3R)-3,4-bis(octadeca-9,12-dienoxy)pyrrolidin-1-yl]ethanone |
| SMILES | CCCCCC=CCC=CCCCCCCCCOC1CN(C(=O)CN)C[C@H]1OCCCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C42H76N2O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-46-40-38-44(42(45)37-43)39-41(40)47-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,40-41H,3-10,15-16,21-39,43H2,1-2H3/t40-,41?/m1/s1 |
| InChIKey | ICZJRYMRTIYDEL-AXHXVYJZSA-N |
| XLogP | 11.18 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.08 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|