C26H46N2O5 — CID 88888746
[(3R)-1-[2-(dimethylamino)acetyl]-4-hydroperoxypyrrolidin-3-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 88888746) has the molecular formula C26H46N2O5 and a molecular weight of 466.66 g/mol. Its IUPAC name is [(3R)-1-[2-(dimethylamino)acetyl]-4-hydroperoxypyrrolidin-3-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(3R)-1-[2-(dimethylamino)acetyl]-4-hydroperoxypyrrolidin-3-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 88888746 |
| Molecular Formula | C26H46N2O5 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | [(3R)-1-[2-(dimethylamino)acetyl]-4-hydroperoxypyrrolidin-3-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O[C@@H]1CN(C(=O)CN(C)C)CC1OO |
| InChI | InChI=1S/C26H46N2O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26(30)32-23-20-28(21-24(23)33-31)25(29)22-27(2)3/h8-9,11-12,23-24,31H,4-7,10,13-22H2,1-3H3/b9-8-,12-11-/t23-,24?/m1/s1 |
| InChIKey | KJPBZBVEQJIPTG-WIXITPDUSA-N |
| XLogP | 4.97 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|