C28H50N2O3 — CID 134350290
[(3S)-1-(6-aminohexanoyl)pyrrolidin-3-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 134350290) has the molecular formula C28H50N2O3 and a molecular weight of 462.72 g/mol. Its IUPAC name is [(3S)-1-(6-aminohexanoyl)pyrrolidin-3-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(3S)-1-(6-aminohexanoyl)pyrrolidin-3-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 134350290 |
| Molecular Formula | C28H50N2O3 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.38 |
| IUPAC Name | [(3S)-1-(6-aminohexanoyl)pyrrolidin-3-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O[C@H]1CCN(C(=O)CCCCCN)C1 |
| InChI | InChI=1S/C28H50N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-21-28(32)33-26-22-24-30(25-26)27(31)20-17-16-19-23-29/h6-7,9-10,26H,2-5,8,11-25,29H2,1H3/b7-6-,10-9-/t26-/m0/s1 |
| InChIKey | KOPNGAUEFUBIBI-GSNKAXSMSA-N |
| XLogP | 6.46 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|