C23H41NO2 — CID 134350272
[(3S)-1-methylpyrrolidin-3-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 134350272) has the molecular formula C23H41NO2 and a molecular weight of 363.59 g/mol. Its IUPAC name is [(3S)-1-methylpyrrolidin-3-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(3S)-1-methylpyrrolidin-3-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 134350272 |
| Molecular Formula | C23H41NO2 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | [(3S)-1-methylpyrrolidin-3-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O[C@H]1CCN(C)C1 |
| InChI | InChI=1S/C23H41NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(25)26-22-19-20-24(2)21-22/h7-8,10-11,22H,3-6,9,12-21H2,1-2H3/b8-7-,11-10-/t22-/m0/s1 |
| InChIKey | DXPCTMMYJKLCBB-HOAWFJNZSA-N |
| XLogP | 6.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|