C42H74ClNO4 — CID 54674706
[(3R,4R)-1,1-dimethyl-4-[(9E,12E)-octadeca-9,12-dienoyl]oxypyrrolidin-1-ium-3-yl] (9E,12E)-octadeca-9,12-dienoate chloride (PubChem CID 54674706) has the molecular formula C42H74ClNO4 and a molecular weight of 692.51 g/mol. Its IUPAC name is [(3R,4R)-1,1-dimethyl-4-[(9E,12E)-octadeca-9,12-dienoyl]oxypyrrolidin-1-ium-3-yl] (9E,12E)-octadeca-9,12-dienoate chloride.
| Compound Name | [(3R,4R)-1,1-dimethyl-4-[(9E,12E)-octadeca-9,12-dienoyl]oxypyrrolidin-1-ium-3-yl] (9E,12E)-octadeca-9,12-dienoate chloride |
|---|---|
| PubChem CID | 54674706 |
| Molecular Formula | C42H74ClNO4 |
| Molecular Weight | 692.51 g/mol |
| Exact Mass | 691.53 |
| IUPAC Name | [(3R,4R)-1,1-dimethyl-4-[(9E,12E)-octadeca-9,12-dienoyl]oxypyrrolidin-1-ium-3-yl] (9E,12E)-octadeca-9,12-dienoate chloride |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)O[C@@H]1C[N+](C)(C)C[C@H]1OC(=O)CCCCCCC/C=C/C/C=C/CCCCC.[Cl-] |
| InChI | InChI=1S/C42H74NO4.ClH/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41(44)46-39-37-43(3,4)38-40(39)47-42(45)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;/h13-16,19-22,39-40H,5-12,17-18,23-38H2,1-4H3;1H/q+1;/p-1/b15-13+,16-14+,21-19+,22-20+;/t39-,40-;/m1./s1 |
| InChIKey | UJRICQCTBZOJKO-SZUFHBOJSA-M |
| XLogP | 8.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.51 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|