C22H38O3 — CID 155456376
[(3R)-oxolan-3-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 155456376) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is [(3R)-oxolan-3-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(3R)-oxolan-3-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 155456376 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | [(3R)-oxolan-3-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O[C@@H]1CCOC1 |
| InChI | InChI=1S/C22H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(23)25-21-18-19-24-20-21/h6-7,9-10,21H,2-5,8,11-20H2,1H3/b7-6-,10-9-/t21-/m1/s1 |
| InChIKey | ZYNSPNRVPCGGEK-DSADLTMXSA-N |
| XLogP | 6.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|