C23H43O8P — CID 101347741
[(3R,4S)-4-phosphonoperoxyoxan-3-yl] (Z)-octadec-9-enoate (PubChem CID 101347741) has the molecular formula C23H43O8P and a molecular weight of 478.56 g/mol. Its IUPAC name is [(3R,4S)-4-phosphonoperoxyoxan-3-yl] (Z)-octadec-9-enoate.
| Compound Name | [(3R,4S)-4-phosphonoperoxyoxan-3-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 101347741 |
| Molecular Formula | C23H43O8P |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | [(3R,4S)-4-phosphonoperoxyoxan-3-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O[C@@H]1COCC[C@@H]1OOP(=O)(O)O |
| InChI | InChI=1S/C23H43O8P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(24)29-22-20-28-19-18-21(22)30-31-32(25,26)27/h9-10,21-22H,2-8,11-20H2,1H3,(H2,25,26,27)/b10-9-/t21-,22+/m0/s1 |
| InChIKey | RTYMCRXURZTIOW-AXTSOQQGSA-N |
| XLogP | 5.77 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|