C24H45O7P — CID 11752360
[(2R,3R,4S)-2-methyl-4-phosphonooxyoxan-3-yl] (E)-octadec-9-enoate (PubChem CID 11752360) has the molecular formula C24H45O7P and a molecular weight of 476.59 g/mol. Its IUPAC name is [(2R,3R,4S)-2-methyl-4-phosphonooxyoxan-3-yl] (E)-octadec-9-enoate.
| Compound Name | [(2R,3R,4S)-2-methyl-4-phosphonooxyoxan-3-yl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 11752360 |
| Molecular Formula | C24H45O7P |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | [(2R,3R,4S)-2-methyl-4-phosphonooxyoxan-3-yl] (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)O[C@H]1[C@@H](OP(=O)(O)O)CCO[C@@H]1C |
| InChI | InChI=1S/C24H45O7P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(25)30-24-21(2)29-20-19-22(24)31-32(26,27)28/h10-11,21-22,24H,3-9,12-20H2,1-2H3,(H2,26,27,28)/b11-10+/t21-,22+,24-/m1/s1 |
| InChIKey | BAZRPRSMXJHVIB-ZXTZGFORSA-N |
| XLogP | 6.22 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|