C23H42NaO7P — CID 23670684
sodium [(3R,4R)-3-[(E)-octadec-9-enoyl]oxyoxan-4-yl] hydrogen phosphate (PubChem CID 23670684) has the molecular formula C23H42NaO7P and a molecular weight of 484.55 g/mol. Its IUPAC name is sodium [(3R,4R)-3-[(E)-octadec-9-enoyl]oxyoxan-4-yl] hydrogen phosphate.
| Compound Name | sodium [(3R,4R)-3-[(E)-octadec-9-enoyl]oxyoxan-4-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 23670684 |
| Molecular Formula | C23H42NaO7P |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | sodium [(3R,4R)-3-[(E)-octadec-9-enoyl]oxyoxan-4-yl] hydrogen phosphate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)O[C@@H]1COCC[C@H]1OP(=O)([O-])O.[Na+] |
| InChI | InChI=1S/C23H43O7P.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(24)29-22-20-28-19-18-21(22)30-31(25,26)27;/h9-10,21-22H,2-8,11-20H2,1H3,(H2,25,26,27);/q;+1/p-1/b10-9+;/t21-,22-;/m1./s1 |
| InChIKey | GEIVGUNILPTFOC-WMOSEPNOSA-M |
| XLogP | 2.21 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|