C23H37BO5 — CID 53231487
(2-hydroxy-1,3,2-dioxaborinan-5-yl) (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate (PubChem CID 53231487) has the molecular formula C23H37BO5 and a molecular weight of 404.36 g/mol. Its IUPAC name is (2-hydroxy-1,3,2-dioxaborinan-5-yl) (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate.
| Compound Name | (2-hydroxy-1,3,2-dioxaborinan-5-yl) (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 53231487 |
| Molecular Formula | C23H37BO5 |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | (2-hydroxy-1,3,2-dioxaborinan-5-yl) (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC1COB(O)OC1 |
| InChI | InChI=1S/C23H37BO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(25)29-22-20-27-24(26)28-21-22/h6-7,9-10,12-13,15-16,22,26H,2-5,8,11,14,17-21H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | OSRZATOONNUCBT-DOFZRALJSA-N |
| XLogP | 5.07 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|