C21H36O3 — CID 92852361
[(2S)-oxiran-2-yl]methyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 92852361) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is [(2S)-oxiran-2-yl]methyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(2S)-oxiran-2-yl]methyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 92852361 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | [(2S)-oxiran-2-yl]methyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@@H]1CO1 |
| InChI | InChI=1S/C21H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(22)24-19-20-18-23-20/h6-7,9-10,20H,2-5,8,11-19H2,1H3/b7-6-,10-9-/t20-/m0/s1 |
| InChIKey | LOGTZDQTPQYKEN-GSNKCQISSA-N |
| XLogP | 5.74 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|