C42H76BO8- — CID 170846327
[3-(octadec-9-enoyloxymethyl)-1,4,6,9-tetraoxa-5-boranuidaspiro[4.4]nonan-8-yl]methyl octadec-9-enoate (PubChem CID 170846327) has the molecular formula C42H76BO8- and a molecular weight of 719.87 g/mol. Its IUPAC name is [3-(octadec-9-enoyloxymethyl)-1,4,6,9-tetraoxa-5-boranuidaspiro[4.4]nonan-8-yl]methyl octadec-9-enoate.
| Compound Name | [3-(octadec-9-enoyloxymethyl)-1,4,6,9-tetraoxa-5-boranuidaspiro[4.4]nonan-8-yl]methyl octadec-9-enoate |
|---|---|
| PubChem CID | 170846327 |
| Molecular Formula | C42H76BO8- |
| Molecular Weight | 719.87 g/mol |
| Exact Mass | 719.56 |
| IUPAC Name | [3-(octadec-9-enoyloxymethyl)-1,4,6,9-tetraoxa-5-boranuidaspiro[4.4]nonan-8-yl]methyl octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC1CO[B-]2(OCC(COC(=O)CCCCCCCC=CCCCCCCCC)O2)O1 |
| InChI | InChI=1S/C42H76BO8/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-41(44)46-35-39-37-48-43(50-39)49-38-40(51-43)36-47-42(45)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,39-40H,3-16,21-38H2,1-2H3/q-1 |
| InChIKey | ZMHNXNYYEPGQOF-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.87 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|