C42H77NO4 — CID 71293137
[(3R,4R)-4-[[(Z)-octadec-9-enoyl]oxymethyl]pyrrolidin-3-yl]methyl (Z)-octadec-9-enoate (PubChem CID 71293137) has the molecular formula C42H77NO4 and a molecular weight of 660.08 g/mol. Its IUPAC name is [(3R,4R)-4-[[(Z)-octadec-9-enoyl]oxymethyl]pyrrolidin-3-yl]methyl (Z)-octadec-9-enoate.
| Compound Name | [(3R,4R)-4-[[(Z)-octadec-9-enoyl]oxymethyl]pyrrolidin-3-yl]methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 71293137 |
| Molecular Formula | C42H77NO4 |
| Molecular Weight | 660.08 g/mol |
| Exact Mass | 659.59 |
| IUPAC Name | [(3R,4R)-4-[[(Z)-octadec-9-enoyl]oxymethyl]pyrrolidin-3-yl]methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H]1CNC[C@@H]1COC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C42H77NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-41(44)46-37-39-35-43-36-40(39)38-47-42(45)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,39-40,43H,3-16,21-38H2,1-2H3/b19-17-,20-18-/t39-,40-/m1/s1 |
| InChIKey | NHVZFMCHGMXBRO-VGHPCWFHSA-N |
| XLogP | 11.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.08 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|