C48H88N2O5 — CID 134350287
[(3S,4S)-1-(6-aminohexanoyl)-4-[[(Z)-octadec-9-enoyl]oxymethyl]pyrrolidin-3-yl]methyl (Z)-octadec-9-enoate (PubChem CID 134350287) has the molecular formula C48H88N2O5 and a molecular weight of 773.24 g/mol. Its IUPAC name is [(3S,4S)-1-(6-aminohexanoyl)-4-[[(Z)-octadec-9-enoyl]oxymethyl]pyrrolidin-3-yl]methyl (Z)-octadec-9-enoate.
| Compound Name | [(3S,4S)-1-(6-aminohexanoyl)-4-[[(Z)-octadec-9-enoyl]oxymethyl]pyrrolidin-3-yl]methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 134350287 |
| Molecular Formula | C48H88N2O5 |
| Molecular Weight | 773.24 g/mol |
| Exact Mass | 772.67 |
| IUPAC Name | [(3S,4S)-1-(6-aminohexanoyl)-4-[[(Z)-octadec-9-enoyl]oxymethyl]pyrrolidin-3-yl]methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H]1CN(C(=O)CCCCCN)C[C@H]1COC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C48H88N2O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-33-37-47(52)54-42-44-40-50(46(51)36-32-31-35-39-49)41-45(44)43-55-48(53)38-34-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,44-45H,3-16,21-43,49H2,1-2H3/b19-17-,20-18-/t44-,45-/m0/s1 |
| InChIKey | CYEFAVDGLMLRQW-OQJHDYOOSA-N |
| XLogP | 12.74 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.24 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|