C48H93N3O3 — CID 54674861
(2S)-2,6-diamino-1-[(3S,4S)-3,4-bis[[(E)-octadec-9-enoxy]methyl]pyrrolidin-1-yl]hexan-1-one (PubChem CID 54674861) has the molecular formula C48H93N3O3 and a molecular weight of 760.29 g/mol. Its IUPAC name is (2S)-2,6-diamino-1-[(3S,4S)-3,4-bis[[(E)-octadec-9-enoxy]methyl]pyrrolidin-1-yl]hexan-1-one.
| Compound Name | (2S)-2,6-diamino-1-[(3S,4S)-3,4-bis[[(E)-octadec-9-enoxy]methyl]pyrrolidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 54674861 |
| Molecular Formula | C48H93N3O3 |
| Molecular Weight | 760.29 g/mol |
| Exact Mass | 759.72 |
| IUPAC Name | (2S)-2,6-diamino-1-[(3S,4S)-3,4-bis[[(E)-octadec-9-enoxy]methyl]pyrrolidin-1-yl]hexan-1-one |
| SMILES | CCCCCCCC/C=C/CCCCCCCCOC[C@@H]1CN(C(=O)[C@@H](N)CCCCN)C[C@H]1COCCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C48H93N3O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-39-53-43-45-41-51(48(52)47(50)37-33-34-38-49)42-46(45)44-54-40-36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,45-47H,3-16,21-44,49-50H2,1-2H3/b19-17+,20-18+/t45-,46-,47-/m0/s1 |
| InChIKey | PEPHPGZXHKIZQF-VQYFIYHDSA-N |
| XLogP | 12.63 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.29 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|