C43H80N2O5 — CID 58651713
[6,10-diamino-1-[(Z)-hexadec-8-enoxy]-1,5-dioxodecan-3-yl] (Z)-heptadec-9-enoate (PubChem CID 58651713) has the molecular formula C43H80N2O5 and a molecular weight of 705.12 g/mol. Its IUPAC name is [6,10-diamino-1-[(Z)-hexadec-8-enoxy]-1,5-dioxodecan-3-yl] (Z)-heptadec-9-enoate.
| Compound Name | [6,10-diamino-1-[(Z)-hexadec-8-enoxy]-1,5-dioxodecan-3-yl] (Z)-heptadec-9-enoate |
|---|---|
| PubChem CID | 58651713 |
| Molecular Formula | C43H80N2O5 |
| Molecular Weight | 705.12 g/mol |
| Exact Mass | 704.61 |
| IUPAC Name | [6,10-diamino-1-[(Z)-hexadec-8-enoxy]-1,5-dioxodecan-3-yl] (Z)-heptadec-9-enoate |
| SMILES | CCCCCCC/C=C\CCCCCCCOC(=O)CC(CC(=O)C(N)CCCCN)OC(=O)CCCCCCC/C=C\CCCCCCC |
| InChI | InChI=1S/C43H80N2O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34-42(47)50-39(37-41(46)40(45)33-30-31-35-44)38-43(48)49-36-32-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h15-18,39-40H,3-14,19-38,44-45H2,1-2H3/b17-15-,18-16- |
| InChIKey | IDEIJTBOGIMTSW-IQRFGFHNSA-N |
| XLogP | 11.15 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.12 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|