C43H82INO4 — CID 10771666
trimethyl-[4-[(Z)-octadec-9-enoxy]-2-[(Z)-octadec-9-enoyl]oxy-4-oxobutyl]azanium iodide (PubChem CID 10771666) has the molecular formula C43H82INO4 and a molecular weight of 804.04 g/mol. Its IUPAC name is trimethyl-[4-[(Z)-octadec-9-enoxy]-2-[(Z)-octadec-9-enoyl]oxy-4-oxobutyl]azanium iodide.
| Compound Name | trimethyl-[4-[(Z)-octadec-9-enoxy]-2-[(Z)-octadec-9-enoyl]oxy-4-oxobutyl]azanium iodide |
|---|---|
| PubChem CID | 10771666 |
| Molecular Formula | C43H82INO4 |
| Molecular Weight | 804.04 g/mol |
| Exact Mass | 803.53 |
| IUPAC Name | trimethyl-[4-[(Z)-octadec-9-enoxy]-2-[(Z)-octadec-9-enoyl]oxy-4-oxobutyl]azanium iodide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)CC(C[N+](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCCCC.[I-] |
| InChI | InChI=1S/C43H82NO4.HI/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-47-43(46)39-41(40-44(3,4)5)48-42(45)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;/h20-23,41H,6-19,24-40H2,1-5H3;1H/q+1;/p-1/b22-20-,23-21-; |
| InChIKey | AIQMESIXONQFGH-LQDDAWAPSA-M |
| XLogP | 9.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.04 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|