C19H35NO4 — CID 156961751
3-[(E)-dodec-5-enoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156961751) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is 3-[(E)-dodec-5-enoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(E)-dodec-5-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156961751 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 3-[(E)-dodec-5-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCC/C=C/CCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C19H35NO4/c1-5-6-7-8-9-10-11-12-13-14-19(23)24-17(15-18(21)22)16-20(2,3)4/h10-11,17H,5-9,12-16H2,1-4H3/b11-10+ |
| InChIKey | PETYOUXDCHQKTQ-ZHACJKMWSA-N |
| XLogP | 2.44 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|