C21H39NO4 — CID 57353952
3-tetradec-5-enoyloxy-4-(trimethylazaniumyl)butanoate (PubChem CID 57353952) has the molecular formula C21H39NO4 and a molecular weight of 369.55 g/mol. Its IUPAC name is 3-tetradec-5-enoyloxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-tetradec-5-enoyloxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 57353952 |
| Molecular Formula | C21H39NO4 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | 3-tetradec-5-enoyloxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCCCC=CCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C21H39NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-21(25)26-19(17-20(23)24)18-22(2,3)4/h12-13,19H,5-11,14-18H2,1-4H3 |
| InChIKey | NNCBVXBBLABOCB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|