C25H45NO4 — CID 51000598
3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 51000598) has the molecular formula C25H45NO4 and a molecular weight of 423.64 g/mol. Its IUPAC name is 3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 51000598 |
| Molecular Formula | C25H45NO4 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.33 |
| IUPAC Name | 3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C25H45NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(29)30-23(21-24(27)28)22-26(2,3)4/h9-10,12-13,23H,5-8,11,14-22H2,1-4H3/b10-9-,13-12- |
| InChIKey | MJLXQSQYKZWZCB-UTJQPWESSA-N |
| XLogP | 4.56 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|