C25H41NO4 — CID 171117727
(3R)-3-[(3Z,6Z,9Z,12Z)-octadeca-3,6,9,12-tetraenoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 171117727) has the molecular formula C25H41NO4 and a molecular weight of 419.61 g/mol. Its IUPAC name is (3R)-3-[(3Z,6Z,9Z,12Z)-octadeca-3,6,9,12-tetraenoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | (3R)-3-[(3Z,6Z,9Z,12Z)-octadeca-3,6,9,12-tetraenoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 171117727 |
| Molecular Formula | C25H41NO4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | (3R)-3-[(3Z,6Z,9Z,12Z)-octadeca-3,6,9,12-tetraenoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C25H41NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(29)30-23(21-24(27)28)22-26(2,3)4/h9-10,12-13,15-16,18-19,23H,5-8,11,14,17,20-22H2,1-4H3/b10-9-,13-12-,16-15-,19-18-/t23-/m1/s1 |
| InChIKey | WRGSIKYPDOXSRA-PZSIIWHGSA-N |
| XLogP | 4.11 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|