C26H48N2O5 — CID 142693444
2,6-diaminohexanoyl (Z)-2-acetyloctadec-9-eneperoxoate (PubChem CID 142693444) has the molecular formula C26H48N2O5 and a molecular weight of 468.68 g/mol. Its IUPAC name is 2,6-diaminohexanoyl (Z)-2-acetyloctadec-9-eneperoxoate.
| Compound Name | 2,6-diaminohexanoyl (Z)-2-acetyloctadec-9-eneperoxoate |
|---|---|
| PubChem CID | 142693444 |
| Molecular Formula | C26H48N2O5 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | 2,6-diaminohexanoyl (Z)-2-acetyloctadec-9-eneperoxoate |
| SMILES | CCCCCCCC/C=C\CCCCCCC(C(C)=O)C(=O)OOC(=O)C(N)CCCCN |
| InChI | InChI=1S/C26H48N2O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-23(22(2)29)25(30)32-33-26(31)24(28)20-17-18-21-27/h10-11,23-24H,3-9,12-21,27-28H2,1-2H3/b11-10- |
| InChIKey | RAHMJBHDRNMBHQ-KHPPLWFESA-N |
| XLogP | 5.30 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|