methyl (E)-2-aminododec-6-enoate

C13H25NO2 — CID 175078394

IUPACmethyl (E)-2-aminododec-6-enoate
SMILESCCCCC/C=C/CCCC(N)C(=O)OC
InChIInChI=1S/C13H25NO2/c1-3-4-5-6-7-8-9-10-11-12(14)13(15)16-2/h7-8,12H,3-6,9-11,14H2,1-2H3/b8-7+
InChIKeyKWFDXWLCFQAYDX-BQYQJAHWSA-N
MW227.35 g/mol
LogP2.79
Rot. Bonds9

About methyl (E)-2-aminododec-6-enoate

methyl (E)-2-aminododec-6-enoate (PubChem CID 175078394) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is methyl (E)-2-aminododec-6-enoate.

Molecular Properties

Compound Namemethyl (E)-2-aminododec-6-enoate
PubChem CID175078394
Molecular FormulaC13H25NO2
Molecular Weight227.35 g/mol
Exact Mass227.19
IUPAC Namemethyl (E)-2-aminododec-6-enoate
SMILESCCCCC/C=C/CCCC(N)C(=O)OC
InChIInChI=1S/C13H25NO2/c1-3-4-5-6-7-8-9-10-11-12(14)13(15)16-2/h7-8,12H,3-6,9-11,14H2,1-2H3/b8-7+
InChIKeyKWFDXWLCFQAYDX-BQYQJAHWSA-N
XLogP2.79
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.35
LogP ≤ 52.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl (E)-2-aminododec-6-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-2-aminododec-6-enoate?
The IUPAC name of methyl (E)-2-aminododec-6-enoate (CID 175078394) is methyl (E)-2-aminododec-6-enoate.
What is the SMILES notation for methyl (E)-2-aminododec-6-enoate?
The canonical SMILES for methyl (E)-2-aminododec-6-enoate is CCCCC/C=C/CCCC(N)C(=O)OC.
What is the InChIKey of methyl (E)-2-aminododec-6-enoate?
The InChIKey is KWFDXWLCFQAYDX-BQYQJAHWSA-N. The full InChI is InChI=1S/C13H25NO2/c1-3-4-5-6-7-8-9-10-11-12(14)13(15)16-2/h7-8,12H,3-6,9-11,14H2,1-2H3/b8-7+.
What are the key properties of methyl (E)-2-aminododec-6-enoate?
methyl (E)-2-aminododec-6-enoate has a molecular weight of 227.35 g/mol, XLogP of 2.79, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-2-aminododec-6-enoate is sourced from PubChem (CID 175078394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).