C20H36N2O4 — CID 11783565
dimethyl (2S,5Z,13Z,17S)-2,17-diaminooctadeca-5,13-dienedioate (PubChem CID 11783565) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is dimethyl (2S,5Z,13Z,17S)-2,17-diaminooctadeca-5,13-dienedioate.
| Compound Name | dimethyl (2S,5Z,13Z,17S)-2,17-diaminooctadeca-5,13-dienedioate |
|---|---|
| PubChem CID | 11783565 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | dimethyl (2S,5Z,13Z,17S)-2,17-diaminooctadeca-5,13-dienedioate |
| SMILES | COC(=O)[C@@H](N)CC/C=C\CCCCCC/C=C\CC[C@H](N)C(=O)OC |
| InChI | InChI=1S/C20H36N2O4/c1-25-19(23)17(21)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(22)20(24)26-2/h9-12,17-18H,3-8,13-16,21-22H2,1-2H3/b11-9-,12-10-/t17-,18-/m0/s1 |
| InChIKey | HOESCVOAEUZANY-AKVIFYCRSA-N |
| XLogP | 3.00 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|