C50H100N6O2 — CID 23599721
2,6-diamino-N-[2-[2,6-diaminohexanoyl-[(E)-octadec-9-enyl]amino]ethyl]-N-[(E)-octadec-9-enyl]hexanamide (PubChem CID 23599721) has the molecular formula C50H100N6O2 and a molecular weight of 817.39 g/mol. Its IUPAC name is 2,6-diamino-N-[2-[2,6-diaminohexanoyl-[(E)-octadec-9-enyl]amino]ethyl]-N-[(E)-octadec-9-enyl]hexanamide.
| Compound Name | 2,6-diamino-N-[2-[2,6-diaminohexanoyl-[(E)-octadec-9-enyl]amino]ethyl]-N-[(E)-octadec-9-enyl]hexanamide |
|---|---|
| PubChem CID | 23599721 |
| Molecular Formula | C50H100N6O2 |
| Molecular Weight | 817.39 g/mol |
| Exact Mass | 816.79 |
| IUPAC Name | 2,6-diamino-N-[2-[2,6-diaminohexanoyl-[(E)-octadec-9-enyl]amino]ethyl]-N-[(E)-octadec-9-enyl]hexanamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCCN(CCN(CCCCCCCC/C=C/CCCCCCCC)C(=O)C(N)CCCCN)C(=O)C(N)CCCCN |
| InChI | InChI=1S/C50H100N6O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-37-43-55(49(57)47(53)39-33-35-41-51)45-46-56(50(58)48(54)40-34-36-42-52)44-38-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,47-48H,3-16,21-46,51-54H2,1-2H3/b19-17+,20-18+ |
| InChIKey | NXIFOLBKOMPNLB-XPWSMXQVSA-N |
| XLogP | 11.63 |
| TPSA | 144.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.39 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|