C36H68N6O6 — CID 59792958
[(Z)-hept-4-enyl] 3-[[(2S)-2,6-diaminohexanoyl]-[4-[[(2S)-2,6-diaminohexanoyl]-[3-[(Z)-hept-4-enoxy]-3-oxopropyl]amino]butyl]amino]propanoate (PubChem CID 59792958) has the molecular formula C36H68N6O6 and a molecular weight of 680.98 g/mol. Its IUPAC name is [(Z)-hept-4-enyl] 3-[[(2S)-2,6-diaminohexanoyl]-[4-[[(2S)-2,6-diaminohexanoyl]-[3-[(Z)-hept-4-enoxy]-3-oxopropyl]amino]butyl]amino]propanoate.
| Compound Name | [(Z)-hept-4-enyl] 3-[[(2S)-2,6-diaminohexanoyl]-[4-[[(2S)-2,6-diaminohexanoyl]-[3-[(Z)-hept-4-enoxy]-3-oxopropyl]amino]butyl]amino]propanoate |
|---|---|
| PubChem CID | 59792958 |
| Molecular Formula | C36H68N6O6 |
| Molecular Weight | 680.98 g/mol |
| Exact Mass | 680.52 |
| IUPAC Name | [(Z)-hept-4-enyl] 3-[[(2S)-2,6-diaminohexanoyl]-[4-[[(2S)-2,6-diaminohexanoyl]-[3-[(Z)-hept-4-enoxy]-3-oxopropyl]amino]butyl]amino]propanoate |
| SMILES | CC/C=C\CCCOC(=O)CCN(CCCCN(CCC(=O)OCCC/C=C\CC)C(=O)[C@@H](N)CCCCN)C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C36H68N6O6/c1-3-5-7-9-17-29-47-33(43)21-27-41(35(45)31(39)19-11-13-23-37)25-15-16-26-42(36(46)32(40)20-12-14-24-38)28-22-34(44)48-30-18-10-8-6-4-2/h5-8,31-32H,3-4,9-30,37-40H2,1-2H3/b7-5-,8-6-/t31-,32-/m0/s1 |
| InChIKey | VJJSOPJMRYDUJO-SWYUOOAJSA-N |
| XLogP | 3.70 |
| TPSA | 197.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.98 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|